C23H32O7 — CID 167354285
2-[1-[4-[1-(2-methylprop-2-enoyloxy)-2-propan-2-yloxyethyl]phenoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 167354285) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-[1-[4-[1-(2-methylprop-2-enoyloxy)-2-propan-2-yloxyethyl]phenoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[1-[4-[1-(2-methylprop-2-enoyloxy)-2-propan-2-yloxyethyl]phenoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167354285 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-[1-[4-[1-(2-methylprop-2-enoyloxy)-2-propan-2-yloxyethyl]phenoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(C)Oc1ccc(C(COC(C)C)OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C23H32O7/c1-15(2)22(24)27-13-12-26-18(7)29-20-10-8-19(9-11-20)21(14-28-17(5)6)30-23(25)16(3)4/h8-11,17-18,21H,1,3,12-14H2,2,4-7H3 |
| InChIKey | UDFLOXOBXDUFIZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|