C16H18F2O9S — CID 163698705
1,1-difluoro-2-[2-[1-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]ethoxy]-2-oxoethanesulfonic acid (PubChem CID 163698705) has the molecular formula C16H18F2O9S and a molecular weight of 424.37 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-[1-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]ethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-[1-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]ethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163698705 |
| Molecular Formula | C16H18F2O9S |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1,1-difluoro-2-[2-[1-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]ethoxy]-2-oxoethanesulfonic acid |
| SMILES | C=C(C)C(=O)Oc1ccc(OC(C)OCCOC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H18F2O9S/c1-10(2)14(19)27-13-6-4-12(5-7-13)26-11(3)24-8-9-25-15(20)16(17,18)28(21,22)23/h4-7,11H,1,8-9H2,2-3H3,(H,21,22,23) |
| InChIKey | JZCFZXXNBACYHB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|