C48H42O8 — CID 169009058
[4-[[4-[bis[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl]-[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl] 2-methylprop-2-enoate (PubChem CID 169009058) has the molecular formula C48H42O8 and a molecular weight of 746.86 g/mol. Its IUPAC name is [4-[[4-[bis[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl]-[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[[4-[bis[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl]-[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169009058 |
| Molecular Formula | C48H42O8 |
| Molecular Weight | 746.86 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | [4-[[4-[bis[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl]-[4-(2-methylprop-2-enoyloxy)phenyl]methyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(c2ccc(OC(=O)C(=C)C)cc2)c2ccc(C(c3ccc(OC(=O)C(=C)C)cc3)c3ccc(OC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H42O8/c1-29(2)45(49)53-39-21-13-35(14-22-39)43(36-15-23-40(24-16-36)54-46(50)30(3)4)33-9-11-34(12-10-33)44(37-17-25-41(26-18-37)55-47(51)31(5)6)38-19-27-42(28-20-38)56-48(52)32(7)8/h9-28,43-44H,1,3,5,7H2,2,4,6,8H3 |
| InChIKey | SYDPGDDIQBRGTH-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.86 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|