C15H20O2 — CID 89171123
(4-pentan-2-ylphenyl) 2-methylprop-2-enoate (PubChem CID 89171123) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4-pentan-2-ylphenyl) 2-methylprop-2-enoate.
| Compound Name | (4-pentan-2-ylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89171123 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (4-pentan-2-ylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(C)CCC)cc1 |
| InChI | InChI=1S/C15H20O2/c1-5-6-12(4)13-7-9-14(10-8-13)17-15(16)11(2)3/h7-10,12H,2,5-6H2,1,3-4H3 |
| InChIKey | CFMOHIXUVBGMNA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|