C24H30O2 — CID 57056990
[4-[3-(4-propylphenyl)pentyl]phenyl] 2-methylprop-2-enoate (PubChem CID 57056990) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is [4-[3-(4-propylphenyl)pentyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-(4-propylphenyl)pentyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57056990 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | [4-[3-(4-propylphenyl)pentyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(CCC(CC)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C24H30O2/c1-5-7-19-9-14-22(15-10-19)21(6-2)13-8-20-11-16-23(17-12-20)26-24(25)18(3)4/h9-12,14-17,21H,3,5-8,13H2,1-2,4H3 |
| InChIKey | ORCHFTVTFSLEDC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|