C14H16O3S — CID 139751824
(4-butanoylsulfanylphenyl) 2-methylprop-2-enoate (PubChem CID 139751824) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is (4-butanoylsulfanylphenyl) 2-methylprop-2-enoate.
| Compound Name | (4-butanoylsulfanylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139751824 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (4-butanoylsulfanylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(SC(=O)CCC)cc1 |
| InChI | InChI=1S/C14H16O3S/c1-4-5-13(15)18-12-8-6-11(7-9-12)17-14(16)10(2)3/h6-9H,2,4-5H2,1,3H3 |
| InChIKey | DUBBWPKHYHOXKF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|