C25H24O4S2 — CID 123529035
[4-(2-methylprop-2-enoylsulfanyl)phenyl] 2-methyl-3-[4-(2-methylprop-2-enoylsulfanyl)phenyl]but-2-enoate (PubChem CID 123529035) has the molecular formula C25H24O4S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoylsulfanyl)phenyl] 2-methyl-3-[4-(2-methylprop-2-enoylsulfanyl)phenyl]but-2-enoate.
| Compound Name | [4-(2-methylprop-2-enoylsulfanyl)phenyl] 2-methyl-3-[4-(2-methylprop-2-enoylsulfanyl)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 123529035 |
| Molecular Formula | C25H24O4S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [4-(2-methylprop-2-enoylsulfanyl)phenyl] 2-methyl-3-[4-(2-methylprop-2-enoylsulfanyl)phenyl]but-2-enoate |
| SMILES | C=C(C)C(=O)Sc1ccc(OC(=O)C(C)=C(C)c2ccc(SC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C25H24O4S2/c1-15(2)24(27)30-21-11-7-19(8-12-21)17(5)18(6)23(26)29-20-9-13-22(14-10-20)31-25(28)16(3)4/h7-14H,1,3H2,2,4-6H3 |
| InChIKey | KNNDFPVFOAAQOK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|