C25H29NO3S — CID 135157313
[4-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanylphenyl] 2-methylprop-2-enoate (PubChem CID 135157313) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is [4-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135157313 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [4-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(Sc2ccc(C(=O)C(C)(C)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H29NO3S/c1-18(2)24(28)29-20-10-14-22(15-11-20)30-21-12-8-19(9-13-21)23(27)25(3,4)26-16-6-5-7-17-26/h8-15H,1,5-7,16-17H2,2-4H3 |
| InChIKey | ZLQHXJPSSQDOJS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|