C23H29NO3S — CID 129155328
1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-piperidin-1-ylpropan-1-one (PubChem CID 129155328) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-piperidin-1-ylpropan-1-one.
| Compound Name | 1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 129155328 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-piperidin-1-ylpropan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(Sc2ccc(OCCO)cc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C23H29NO3S/c1-23(2,24-14-4-3-5-15-24)22(26)18-6-10-20(11-7-18)28-21-12-8-19(9-13-21)27-17-16-25/h6-13,25H,3-5,14-17H2,1-2H3 |
| InChIKey | AEHSDQPBZGKVSG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |