C11H11NO3 — CID 53440858
(4-carbamoylphenyl) 2-methylprop-2-enoate (PubChem CID 53440858) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (4-carbamoylphenyl) 2-methylprop-2-enoate.
| Compound Name | (4-carbamoylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 53440858 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (4-carbamoylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H11NO3/c1-7(2)11(14)15-9-5-3-8(4-6-9)10(12)13/h3-6H,1H2,2H3,(H2,12,13) |
| InChIKey | PNAUPYPJZFBZHP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|