C16H18O2 — CID 126523851
[4-[(3E)-hexa-3,5-dien-3-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 126523851) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is [4-[(3E)-hexa-3,5-dien-3-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(3E)-hexa-3,5-dien-3-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126523851 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [4-[(3E)-hexa-3,5-dien-3-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C/C=C(\CC)c1ccc(OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C16H18O2/c1-5-7-13(6-2)14-8-10-15(11-9-14)18-16(17)12(3)4/h5,7-11H,1,3,6H2,2,4H3/b13-7+ |
| InChIKey | XWFSCTKOUCLWSD-NTUHNPAUSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|