C18H20O3 — CID 137428614
[4-[(2Z,4E)-1-hydroxy-4-methylhepta-2,4,6-trien-2-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 137428614) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is [4-[(2Z,4E)-1-hydroxy-4-methylhepta-2,4,6-trien-2-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(2Z,4E)-1-hydroxy-4-methylhepta-2,4,6-trien-2-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137428614 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [4-[(2Z,4E)-1-hydroxy-4-methylhepta-2,4,6-trien-2-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C/C=C(C)/C=C(\CO)c1ccc(OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C18H20O3/c1-5-6-14(4)11-16(12-19)15-7-9-17(10-8-15)21-18(20)13(2)3/h5-11,19H,1-2,12H2,3-4H3/b14-6+,16-11+ |
| InChIKey | WHSQFHZRXUPOAZ-MWTVRSFGSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|