C30H28O6 — CID 145309455
[4-[4-[(3E)-3,5-bis(2-methylprop-2-enoyloxy)hexa-1,3,5-trien-2-yl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 145309455) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is [4-[4-[(3E)-3,5-bis(2-methylprop-2-enoyloxy)hexa-1,3,5-trien-2-yl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[(3E)-3,5-bis(2-methylprop-2-enoyloxy)hexa-1,3,5-trien-2-yl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145309455 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [4-[4-[(3E)-3,5-bis(2-methylprop-2-enoyloxy)hexa-1,3,5-trien-2-yl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(/C=C(/OC(=O)C(=C)C)C(=C)c1ccc(-c2ccc(OC(=O)C(=C)C)cc2)cc1)OC(=O)C(=C)C |
| InChI | InChI=1S/C30H28O6/c1-18(2)28(31)34-21(7)17-27(36-30(33)20(5)6)22(8)23-9-11-24(12-10-23)25-13-15-26(16-14-25)35-29(32)19(3)4/h9-17H,1,3,5,7-8H2,2,4,6H3/b27-17+ |
| InChIKey | LWGKHUCXFHNPHG-WPWMEQJKSA-N |
| XLogP | 6.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|