C20H20O3 — CID 118907469
[4-[4-(2-methylprop-1-enoxy)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118907469) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is [4-[4-(2-methylprop-1-enoxy)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(2-methylprop-1-enoxy)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118907469 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-[4-(2-methylprop-1-enoxy)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC=C(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H20O3/c1-14(2)13-22-18-9-5-16(6-10-18)17-7-11-19(12-8-17)23-20(21)15(3)4/h5-13H,3H2,1-2,4H3 |
| InChIKey | WIXQCUWTLIRFTC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|