C21H22O4 — CID 144966682
[4-(4-formyloxyphenyl)phenyl] 2-methylprop-2-enoate;2-methylprop-1-ene (PubChem CID 144966682) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is [4-(4-formyloxyphenyl)phenyl] 2-methylprop-2-enoate;2-methylprop-1-ene.
| Compound Name | [4-(4-formyloxyphenyl)phenyl] 2-methylprop-2-enoate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 144966682 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [4-(4-formyloxyphenyl)phenyl] 2-methylprop-2-enoate;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)C(=O)Oc1ccc(-c2ccc(OC=O)cc2)cc1 |
| InChI | InChI=1S/C17H14O4.C4H8/c1-12(2)17(19)21-16-9-5-14(6-10-16)13-3-7-15(8-4-13)20-11-18;1-4(2)3/h3-11H,1H2,2H3;1H2,2-3H3 |
| InChIKey | UYDUYRGGPZLWSY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|