C26H22O7 — CID 144771997
[4-[3-formyloxy-4-(4-formyloxy-2-methylphenyl)-5-methoxyphenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 144771997) has the molecular formula C26H22O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is [4-[3-formyloxy-4-(4-formyloxy-2-methylphenyl)-5-methoxyphenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-formyloxy-4-(4-formyloxy-2-methylphenyl)-5-methoxyphenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144771997 |
| Molecular Formula | C26H22O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [4-[3-formyloxy-4-(4-formyloxy-2-methylphenyl)-5-methoxyphenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC)c(-c3ccc(OC=O)cc3C)c(OC=O)c2)cc1 |
| InChI | InChI=1S/C26H22O7/c1-16(2)26(29)33-20-7-5-18(6-8-20)19-12-23(30-4)25(24(13-19)32-15-28)22-10-9-21(31-14-27)11-17(22)3/h5-15H,1H2,2-4H3 |
| InChIKey | BIHAQGXOQZWKAN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|