C25H24O6 — CID 123402652
2-[4-[2-methyl-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate (PubChem CID 123402652) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-[4-[2-methyl-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-methyl-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123402652 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[4-[2-methyl-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=COc1ccc(-c2ccc(OC=COC(=O)C(=C)C)cc2C)cc1 |
| InChI | InChI=1S/C25H24O6/c1-17(2)24(26)30-14-12-28-21-8-6-20(7-9-21)23-11-10-22(16-19(23)5)29-13-15-31-25(27)18(3)4/h6-16H,1,3H2,2,4-5H3 |
| InChIKey | CCCZTPNKYYRZJD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|