C30H25FO6 — CID 123553742
2-[4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate (PubChem CID 123553742) has the molecular formula C30H25FO6 and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-[4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123553742 |
| Molecular Formula | C30H25FO6 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]phenyl]phenoxy]ethenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=COc1ccc(-c2ccc(-c3ccc(OC=COC(=O)C(=C)C)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C30H25FO6/c1-20(2)29(32)36-17-15-34-26-12-9-23(10-13-26)22-5-7-24(8-6-22)25-11-14-28(27(31)19-25)35-16-18-37-30(33)21(3)4/h5-19H,1,3H2,2,4H3 |
| InChIKey | XZUHUVJKBAEXAS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|