C22H19FO5 — CID 123687311
2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethenyl 2-methylprop-2-enoate (PubChem CID 123687311) has the molecular formula C22H19FO5 and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethenyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123687311 |
| Molecular Formula | C22H19FO5 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=COc1ccc(-c2ccc(OC(=O)C(=C)C)cc2)cc1F |
| InChI | InChI=1S/C22H19FO5/c1-14(2)21(24)27-12-11-26-20-10-7-17(13-19(20)23)16-5-8-18(9-6-16)28-22(25)15(3)4/h5-13H,1,3H2,2,4H3 |
| InChIKey | SHKXLYBIXGYGBX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|