C36H34O12 — CID 123774805
2-[3-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenoxy]ethenyl 2-methylprop-2-enoate (PubChem CID 123774805) has the molecular formula C36H34O12 and a molecular weight of 658.66 g/mol. Its IUPAC name is 2-[3-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenoxy]ethenyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenoxy]ethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123774805 |
| Molecular Formula | C36H34O12 |
| Molecular Weight | 658.66 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | 2-[3-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethenoxy]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethenoxy]phenoxy]ethenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=COc1cc(OC=COC(=O)C(=C)C)cc(-c2cc(OC=COC(=O)C(=C)C)cc(OC=COC(=O)C(=C)C)c2)c1 |
| InChI | InChI=1S/C36H34O12/c1-23(2)33(37)45-13-9-41-29-17-27(18-30(21-29)42-10-14-46-34(38)24(3)4)28-19-31(43-11-15-47-35(39)25(5)6)22-32(20-28)44-12-16-48-36(40)26(7)8/h9-22H,1,3,5,7H2,2,4,6,8H3 |
| InChIKey | GQWDDGHZQYUQKV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|