C36H34O10 — CID 163750440
[(Z)-2-[2-(2-methylprop-2-enoyloxy)-4-[7-(2-methylprop-2-enoyloxy)-6-[(Z)-2-(2-methylprop-2-enoyloxy)ethenoxy]naphthalen-2-yl]phenoxy]ethenyl] 2-methylpropanoate (PubChem CID 163750440) has the molecular formula C36H34O10 and a molecular weight of 626.66 g/mol. Its IUPAC name is [(Z)-2-[2-(2-methylprop-2-enoyloxy)-4-[7-(2-methylprop-2-enoyloxy)-6-[(Z)-2-(2-methylprop-2-enoyloxy)ethenoxy]naphthalen-2-yl]phenoxy]ethenyl] 2-methylpropanoate.
| Compound Name | [(Z)-2-[2-(2-methylprop-2-enoyloxy)-4-[7-(2-methylprop-2-enoyloxy)-6-[(Z)-2-(2-methylprop-2-enoyloxy)ethenoxy]naphthalen-2-yl]phenoxy]ethenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163750440 |
| Molecular Formula | C36H34O10 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | [(Z)-2-[2-(2-methylprop-2-enoyloxy)-4-[7-(2-methylprop-2-enoyloxy)-6-[(Z)-2-(2-methylprop-2-enoyloxy)ethenoxy]naphthalen-2-yl]phenoxy]ethenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)O/C=C\Oc1cc2ccc(-c3ccc(O/C=C\OC(=O)C(C)C)c(OC(=O)C(=C)C)c3)cc2cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C36H34O10/c1-21(2)33(37)43-15-13-41-29-12-11-26(19-31(29)45-35(39)23(5)6)25-9-10-27-18-30(42-14-16-44-34(38)22(3)4)32(20-28(27)17-25)46-36(40)24(7)8/h9-21H,3,5,7H2,1-2,4,6,8H3/b15-13-,16-14- |
| InChIKey | LPNDICBLOLAAPP-VMNXYWKNSA-N |
| XLogP | 7.49 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|