C22H25O5P — CID 145389550
[4-(3,4-dimethoxyphenyl)-3-phosphanylphenyl] 2-methylprop-2-enoate;2-methylprop-2-enal (PubChem CID 145389550) has the molecular formula C22H25O5P and a molecular weight of 400.41 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)-3-phosphanylphenyl] 2-methylprop-2-enoate;2-methylprop-2-enal.
| Compound Name | [4-(3,4-dimethoxyphenyl)-3-phosphanylphenyl] 2-methylprop-2-enoate;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145389550 |
| Molecular Formula | C22H25O5P |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)-3-phosphanylphenyl] 2-methylprop-2-enoate;2-methylprop-2-enal |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC)c(OC)c2)c(P)c1.C=C(C)C=O |
| InChI | InChI=1S/C18H19O4P.C4H6O/c1-11(2)18(19)22-13-6-7-14(17(23)10-13)12-5-8-15(20-3)16(9-12)21-4;1-4(2)3-5/h5-10H,1,23H2,2-4H3;3H,1H2,2H3 |
| InChIKey | MFRFCRGRSSTJNT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|