C39H35F5O6 — CID 144737106
[2-(2,2-difluoroethenoxy)-4-[4-[4-[3-(2,2-difluoroethenoxy)-4-methoxyphenyl]-2-fluorophenyl]phenyl]phenyl] 2-methylprop-2-enoate;ethane;2-methylprop-2-enal (PubChem CID 144737106) has the molecular formula C39H35F5O6 and a molecular weight of 694.69 g/mol. Its IUPAC name is [2-(2,2-difluoroethenoxy)-4-[4-[4-[3-(2,2-difluoroethenoxy)-4-methoxyphenyl]-2-fluorophenyl]phenyl]phenyl] 2-methylprop-2-enoate;ethane;2-methylprop-2-enal.
| Compound Name | [2-(2,2-difluoroethenoxy)-4-[4-[4-[3-(2,2-difluoroethenoxy)-4-methoxyphenyl]-2-fluorophenyl]phenyl]phenyl] 2-methylprop-2-enoate;ethane;2-methylprop-2-enal |
|---|---|
| PubChem CID | 144737106 |
| Molecular Formula | C39H35F5O6 |
| Molecular Weight | 694.69 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | [2-(2,2-difluoroethenoxy)-4-[4-[4-[3-(2,2-difluoroethenoxy)-4-methoxyphenyl]-2-fluorophenyl]phenyl]phenyl] 2-methylprop-2-enoate;ethane;2-methylprop-2-enal |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(-c4ccc(OC)c(OC=C(F)F)c4)cc3F)cc2)cc1OC=C(F)F.C=C(C)C=O.CC |
| InChI | InChI=1S/C33H23F5O5.C4H6O.C2H6/c1-19(2)33(39)43-28-13-10-23(15-30(28)42-18-32(37)38)20-4-6-21(7-5-20)25-11-8-22(14-26(25)34)24-9-12-27(40-3)29(16-24)41-17-31(35)36;1-4(2)3-5;1-2/h4-18H,1H2,2-3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | QZINXMPZFKPDNU-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.69 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|