C38H25F3O9 — CID 118907389
[4-[4-[3-(2,2-difluoroethenoxy)-4-[3,4-di(prop-2-enoyloxy)phenyl]phenyl]-3-fluorophenyl]-2-prop-2-enoyloxyphenyl] prop-2-enoate (PubChem CID 118907389) has the molecular formula C38H25F3O9 and a molecular weight of 682.60 g/mol. Its IUPAC name is [4-[4-[3-(2,2-difluoroethenoxy)-4-[3,4-di(prop-2-enoyloxy)phenyl]phenyl]-3-fluorophenyl]-2-prop-2-enoyloxyphenyl] prop-2-enoate.
| Compound Name | [4-[4-[3-(2,2-difluoroethenoxy)-4-[3,4-di(prop-2-enoyloxy)phenyl]phenyl]-3-fluorophenyl]-2-prop-2-enoyloxyphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 118907389 |
| Molecular Formula | C38H25F3O9 |
| Molecular Weight | 682.60 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | [4-[4-[3-(2,2-difluoroethenoxy)-4-[3,4-di(prop-2-enoyloxy)phenyl]phenyl]-3-fluorophenyl]-2-prop-2-enoyloxyphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(-c3ccc(-c4ccc(OC(=O)C=C)c(OC(=O)C=C)c4)c(OC=C(F)F)c3)c(F)c2)cc1OC(=O)C=C |
| InChI | InChI=1S/C38H25F3O9/c1-5-35(42)47-29-15-11-23(18-32(29)49-37(44)7-3)22-9-13-26(28(39)17-22)24-10-14-27(31(19-24)46-21-34(40)41)25-12-16-30(48-36(43)6-2)33(20-25)50-38(45)8-4/h5-21H,1-4H2 |
| InChIKey | IQMBEFFCWXDRDW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.60 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|