C32H29FO7 — CID 170075434
[4-[3-fluoro-4-[4-(3-methyl-2-oxobut-3-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-methoxyphenyl] 2-methylprop-2-enoate (PubChem CID 170075434) has the molecular formula C32H29FO7 and a molecular weight of 544.58 g/mol. Its IUPAC name is [4-[3-fluoro-4-[4-(3-methyl-2-oxobut-3-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-methoxyphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-fluoro-4-[4-(3-methyl-2-oxobut-3-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-methoxyphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170075434 |
| Molecular Formula | C32H29FO7 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | [4-[3-fluoro-4-[4-(3-methyl-2-oxobut-3-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-methoxyphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)COc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)c(OC)c3)cc2F)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C32H29FO7/c1-18(2)26(34)17-38-27-12-10-23(16-30(27)40-32(36)20(5)6)24-11-8-21(14-25(24)33)22-9-13-28(29(15-22)37-7)39-31(35)19(3)4/h8-16H,1,3,5,17H2,2,4,6-7H3 |
| InChIKey | MAVHWUSFHIXTON-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|