C21H23FO4 — CID 134193060
[5-(2-fluoro-4-propylphenyl)-2-(2-hydroxyethoxy)phenyl] 2-methylprop-2-enoate (PubChem CID 134193060) has the molecular formula C21H23FO4 and a molecular weight of 358.41 g/mol. Its IUPAC name is [5-(2-fluoro-4-propylphenyl)-2-(2-hydroxyethoxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [5-(2-fluoro-4-propylphenyl)-2-(2-hydroxyethoxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193060 |
| Molecular Formula | C21H23FO4 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [5-(2-fluoro-4-propylphenyl)-2-(2-hydroxyethoxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(-c2ccc(CCC)cc2F)ccc1OCCO |
| InChI | InChI=1S/C21H23FO4/c1-4-5-15-6-8-17(18(22)12-15)16-7-9-19(25-11-10-23)20(13-16)26-21(24)14(2)3/h6-9,12-13,23H,2,4-5,10-11H2,1,3H3 |
| InChIKey | DEFXDGTZVOLHDB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|