C15H9N3O2 — CID 89002964
[4-(1,2,2-tricyanoethenyl)phenyl] 2-methylprop-2-enoate (PubChem CID 89002964) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is [4-(1,2,2-tricyanoethenyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(1,2,2-tricyanoethenyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89002964 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | [4-(1,2,2-tricyanoethenyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C15H9N3O2/c1-10(2)15(19)20-13-5-3-11(4-6-13)14(9-18)12(7-16)8-17/h3-6H,1H2,2H3 |
| InChIKey | IUWRTFNOLUJTJL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|