C13H14O7S — CID 58372354
2-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyethanesulfonic acid (PubChem CID 58372354) has the molecular formula C13H14O7S and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58372354 |
| Molecular Formula | C13H14O7S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)OCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H14O7S/c1-9(2)12(14)20-11-5-3-10(4-6-11)13(15)19-7-8-21(16,17)18/h3-6H,1,7-8H2,2H3,(H,16,17,18) |
| InChIKey | LMXNXMIWPXZFPD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|