C34H34O6 — CID 147925089
[4-[bis[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]methyl]-3-methylphenyl] 2-methylprop-2-enoate (PubChem CID 147925089) has the molecular formula C34H34O6 and a molecular weight of 538.64 g/mol. Its IUPAC name is [4-[bis[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]methyl]-3-methylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[bis[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]methyl]-3-methylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 147925089 |
| Molecular Formula | C34H34O6 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | [4-[bis[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]methyl]-3-methylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(c2ccc(OC(=O)C(=C)C)cc2C)c2ccc(OC(=O)C(=C)C)cc2C)c(C)c1 |
| InChI | InChI=1S/C34H34O6/c1-19(2)32(35)38-25-10-13-28(22(7)16-25)31(29-14-11-26(17-23(29)8)39-33(36)20(3)4)30-15-12-27(18-24(30)9)40-34(37)21(5)6/h10-18,31H,1,3,5H2,2,4,6-9H3 |
| InChIKey | IITQUGXAIRARQT-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|