C49H64O15 — CID 58876667
2-[2-[1-[4-[bis[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]phenyl]methyl]phenoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 58876667) has the molecular formula C49H64O15 and a molecular weight of 893.04 g/mol. Its IUPAC name is 2-[2-[1-[4-[bis[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]phenyl]methyl]phenoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[1-[4-[bis[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]phenyl]methyl]phenoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58876667 |
| Molecular Formula | C49H64O15 |
| Molecular Weight | 893.04 g/mol |
| Exact Mass | 892.42 |
| IUPAC Name | 2-[2-[1-[4-[bis[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]phenyl]methyl]phenoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOC(C)Oc1ccc(C(c2ccc(OC(C)OCCOCCOC(=O)C(=C)C)cc2)c2ccc(OC(C)OCCOCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C49H64O15/c1-34(2)47(50)59-31-25-53-22-28-56-37(7)62-43-16-10-40(11-17-43)46(41-12-18-44(19-13-41)63-38(8)57-29-23-54-26-32-60-48(51)35(3)4)42-14-20-45(21-15-42)64-39(9)58-30-24-55-27-33-61-49(52)36(5)6/h10-21,37-39,46H,1,3,5,22-33H2,2,4,6-9H3 |
| InChIKey | LXXUKXRMVOTLPV-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 161.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.04 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|