C13H16O5S — CID 88730575
4-[2-(2-methylprop-2-enoyloxy)propyl]benzenesulfonic acid (PubChem CID 88730575) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-[2-(2-methylprop-2-enoyloxy)propyl]benzenesulfonic acid.
| Compound Name | 4-[2-(2-methylprop-2-enoyloxy)propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88730575 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-[2-(2-methylprop-2-enoyloxy)propyl]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)OC(C)Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H16O5S/c1-9(2)13(14)18-10(3)8-11-4-6-12(7-5-11)19(15,16)17/h4-7,10H,1,8H2,2-3H3,(H,15,16,17) |
| InChIKey | YCDCMUWYKWZUAF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|