C24H32N2O10S2 — CID 102204347
4-[(2S)-2-amino-3-[6-[(2S)-2-amino-3-(4-sulfophenyl)propanoyl]oxyhexoxy]-3-oxopropyl]benzenesulfonic acid (PubChem CID 102204347) has the molecular formula C24H32N2O10S2 and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-[6-[(2S)-2-amino-3-(4-sulfophenyl)propanoyl]oxyhexoxy]-3-oxopropyl]benzenesulfonic acid.
| Compound Name | 4-[(2S)-2-amino-3-[6-[(2S)-2-amino-3-(4-sulfophenyl)propanoyl]oxyhexoxy]-3-oxopropyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102204347 |
| Molecular Formula | C24H32N2O10S2 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 4-[(2S)-2-amino-3-[6-[(2S)-2-amino-3-(4-sulfophenyl)propanoyl]oxyhexoxy]-3-oxopropyl]benzenesulfonic acid |
| SMILES | N[C@@H](Cc1ccc(S(=O)(=O)O)cc1)C(=O)OCCCCCCOC(=O)[C@@H](N)Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H32N2O10S2/c25-21(15-17-5-9-19(10-6-17)37(29,30)31)23(27)35-13-3-1-2-4-14-36-24(28)22(26)16-18-7-11-20(12-8-18)38(32,33)34/h5-12,21-22H,1-4,13-16,25-26H2,(H,29,30,31)(H,32,33,34)/t21-,22-/m0/s1 |
| InChIKey | RZYDLZXIIDRUKM-VXKWHMMOSA-N |
| XLogP | 1.27 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|