C18H27NO3 — CID 170530456
[(Z)-non-6-enyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 170530456) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [(Z)-non-6-enyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | [(Z)-non-6-enyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 170530456 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [(Z)-non-6-enyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | CC/C=C\CCCCCOC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-2-3-4-5-6-7-8-13-22-18(21)17(19)14-15-9-11-16(20)12-10-15/h3-4,9-12,17,20H,2,5-8,13-14,19H2,1H3/b4-3-/t17-/m0/s1 |
| InChIKey | JHFQBFVRPSJLDZ-LIMHQNJXSA-N |
| XLogP | 3.33 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|