C18H33NO3 — CID 142497424
ethane;3-methylbutyl 2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 142497424) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is ethane;3-methylbutyl 2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | ethane;3-methylbutyl 2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 142497424 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | ethane;3-methylbutyl 2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | CC.CC.CC(C)CCOC(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H21NO3.2C2H6/c1-10(2)7-8-18-14(17)13(15)9-11-3-5-12(16)6-4-11;2*1-2/h3-6,10,13,16H,7-9,15H2,1-2H3;2*1-2H3 |
| InChIKey | ZVGYUVXOKDXRMX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |