C27H49NO5S — CID 86742967
4-methylbenzenesulfonic acid;tetradecyl (2S)-2-amino-4-methylpentanoate (PubChem CID 86742967) has the molecular formula C27H49NO5S and a molecular weight of 499.76 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;tetradecyl (2S)-2-amino-4-methylpentanoate.
| Compound Name | 4-methylbenzenesulfonic acid;tetradecyl (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 86742967 |
| Molecular Formula | C27H49NO5S |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | 4-methylbenzenesulfonic acid;tetradecyl (2S)-2-amino-4-methylpentanoate |
| SMILES | CCCCCCCCCCCCCCOC(=O)[C@@H](N)CC(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H41NO2.C7H8O3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-23-20(22)19(21)17-18(2)3;1-6-2-4-7(5-3-6)11(8,9)10/h18-19H,4-17,21H2,1-3H3;2-5H,1H3,(H,8,9,10)/t19-;/m0./s1 |
| InChIKey | GZJWYXRBGRTUTI-FYZYNONXSA-N |
| XLogP | 6.85 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|