C20H29NO8S2 — CID 175907488
(2S)-2-amino-4-methylpentanoic acid;bis(4-methylbenzenesulfonic acid) (PubChem CID 175907488) has the molecular formula C20H29NO8S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;bis(4-methylbenzenesulfonic acid).
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 175907488 |
| Molecular Formula | C20H29NO8S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;bis(4-methylbenzenesulfonic acid) |
| SMILES | CC(C)C[C@H](N)C(=O)O.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/2C7H8O3S.C6H13NO2/c2*1-6-2-4-7(5-3-6)11(8,9)10;1-4(2)3-5(7)6(8)9/h2*2-5H,1H3,(H,8,9,10);4-5H,3,7H2,1-2H3,(H,8,9)/t;;5-/m..0/s1 |
| InChIKey | BQKYJLHLNZCHNS-BYOYUIHVSA-N |
| XLogP | 2.93 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|