C12H21NO9S3 — CID 90134523
(2S)-2-amino-4-methylsulfanylbutanoic acid;4-methylbenzenesulfonic acid;sulfuric acid (PubChem CID 90134523) has the molecular formula C12H21NO9S3 and a molecular weight of 419.50 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;4-methylbenzenesulfonic acid;sulfuric acid.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;4-methylbenzenesulfonic acid;sulfuric acid |
|---|---|
| PubChem CID | 90134523 |
| Molecular Formula | C12H21NO9S3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;4-methylbenzenesulfonic acid;sulfuric acid |
| SMILES | CSCC[C@H](N)C(=O)O.Cc1ccc(S(=O)(=O)O)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H8O3S.C5H11NO2S.H2O4S/c1-6-2-4-7(5-3-6)11(8,9)10;1-9-3-2-4(6)5(7)8;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);4H,2-3,6H2,1H3,(H,7,8);(H2,1,2,3,4)/t;4-;/m.0./s1 |
| InChIKey | ZIPUOVRBWHBMKX-INZIHYEWSA-N |
| XLogP | 0.74 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|