C22H37FN2O7S — CID 174441504
tert-butyl 2,5-diamino-3-(2-fluoro-1-hydroxyethyl)-7-methyl-4-oxooctanoate;4-methylbenzenesulfonic acid (PubChem CID 174441504) has the molecular formula C22H37FN2O7S and a molecular weight of 492.61 g/mol. Its IUPAC name is tert-butyl 2,5-diamino-3-(2-fluoro-1-hydroxyethyl)-7-methyl-4-oxooctanoate;4-methylbenzenesulfonic acid.
| Compound Name | tert-butyl 2,5-diamino-3-(2-fluoro-1-hydroxyethyl)-7-methyl-4-oxooctanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174441504 |
| Molecular Formula | C22H37FN2O7S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | tert-butyl 2,5-diamino-3-(2-fluoro-1-hydroxyethyl)-7-methyl-4-oxooctanoate;4-methylbenzenesulfonic acid |
| SMILES | CC(C)CC(N)C(=O)C(C(O)CF)C(N)C(=O)OC(C)(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H29FN2O4.C7H8O3S/c1-8(2)6-9(17)13(20)11(10(19)7-16)12(18)14(21)22-15(3,4)5;1-6-2-4-7(5-3-6)11(8,9)10/h8-12,19H,6-7,17-18H2,1-5H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | QCOPKGSDOIQRND-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|