C14H23NO6S — CID 91824235
2-hydroxyethyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid (PubChem CID 91824235) has the molecular formula C14H23NO6S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-hydroxyethyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid.
| Compound Name | 2-hydroxyethyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 91824235 |
| Molecular Formula | C14H23NO6S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-hydroxyethyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid |
| SMILES | CC(C)[C@H](N)C(=O)OCCO.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H15NO3.C7H8O3S/c1-5(2)6(8)7(10)11-4-3-9;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,9H,3-4,8H2,1-2H3;2-5H,1H3,(H,8,9,10)/t6-;/m0./s1 |
| InChIKey | KIQNQGPNCRYWKY-RGMNGODLSA-N |
| XLogP | 0.75 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|