C14H24O7S — CID 158908873
1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol;4-methylbenzenesulfonic acid (PubChem CID 158908873) has the molecular formula C14H24O7S and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol;4-methylbenzenesulfonic acid.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 158908873 |
| Molecular Formula | C14H24O7S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol;4-methylbenzenesulfonic acid |
| SMILES | CC(O)COCCOCCO.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H16O4.C7H8O3S/c1-7(9)6-11-5-4-10-3-2-8;1-6-2-4-7(5-3-6)11(8,9)10/h7-9H,2-6H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | JGJTXXOCEJMMCR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|