C14H22O6S — CID 69492718
2-[2-[2-methoxy-2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethanol (PubChem CID 69492718) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-[2-[2-methoxy-2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-methoxy-2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 69492718 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[2-[2-methoxy-2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethanol |
| SMILES | COC(COCCOCCO)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H22O6S/c1-12-3-5-13(6-4-12)21(16,17)14(18-2)11-20-10-9-19-8-7-15/h3-6,14-15H,7-11H2,1-2H3 |
| InChIKey | UZVXCAGRATVTRL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|