C11H17N3O6S — CID 175345739
1-azido-2-(2-hydroxyethoxy)ethanol;4-methylbenzenesulfonic acid (PubChem CID 175345739) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-azido-2-(2-hydroxyethoxy)ethanol;4-methylbenzenesulfonic acid.
| Compound Name | 1-azido-2-(2-hydroxyethoxy)ethanol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175345739 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-azido-2-(2-hydroxyethoxy)ethanol;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[N-]=[N+]=NC(O)COCCO |
| InChI | InChI=1S/C7H8O3S.C4H9N3O3/c1-6-2-4-7(5-3-6)11(8,9)10;5-7-6-4(9)3-10-2-1-8/h2-5H,1H3,(H,8,9,10);4,8-9H,1-3H2 |
| InChIKey | GDCUQGCQKAZHMA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|