C13H28O7 — CID 86587580
1-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol (PubChem CID 86587580) has the molecular formula C13H28O7 and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol.
| Compound Name | 1-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 86587580 |
| Molecular Formula | C13H28O7 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol |
| SMILES | CC(O)COCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C13H28O7/c1-13(15)12-20-11-10-19-9-8-18-7-6-17-5-4-16-3-2-14/h13-15H,2-12H2,1H3 |
| InChIKey | DNZFFDAMYHOZRX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|