C21H40O13 — CID 163538655
but-2-enedioic acid;1-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol (PubChem CID 163538655) has the molecular formula C21H40O13 and a molecular weight of 500.54 g/mol. Its IUPAC name is but-2-enedioic acid;1-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol.
| Compound Name | but-2-enedioic acid;1-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 163538655 |
| Molecular Formula | C21H40O13 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | but-2-enedioic acid;1-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-ol |
| SMILES | CC(O)COCCOCCOCCOCCOCCOCCOCCO.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H36O9.C4H4O4/c1-17(19)16-26-15-14-25-13-12-24-11-10-23-9-8-22-7-6-21-5-4-20-3-2-18;5-3(6)1-2-4(7)8/h17-19H,2-16H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DZEFKZJHEGOZID-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|