C13H24O9 — CID 88505451
(Z)-but-2-enedioic acid;2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 88505451) has the molecular formula C13H24O9 and a molecular weight of 324.33 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | (Z)-but-2-enedioic acid;2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 88505451 |
| Molecular Formula | C13H24O9 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | COCCOCCOCCOCCO.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H20O5.C4H4O4/c1-11-4-5-13-8-9-14-7-6-12-3-2-10;5-3(6)1-2-4(7)8/h10H,2-9H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UUFNQDNUNWDQEM-BTJKTKAUSA-N |
| XLogP | -0.61 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|