C9H16O5 — CID 175090544
5-[2-(2-hydroxyethoxy)ethoxy]pent-2-enoic acid (PubChem CID 175090544) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 5-[2-(2-hydroxyethoxy)ethoxy]pent-2-enoic acid.
| Compound Name | 5-[2-(2-hydroxyethoxy)ethoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 175090544 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-[2-(2-hydroxyethoxy)ethoxy]pent-2-enoic acid |
| SMILES | O=C(O)C=CCCOCCOCCO |
| InChI | InChI=1S/C9H16O5/c10-4-6-14-8-7-13-5-2-1-3-9(11)12/h1,3,10H,2,4-8H2,(H,11,12) |
| InChIKey | RGLOWGQRWUMUBA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|