C20H36O12 — CID 87256441
bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] (Z)-but-2-enedioate (PubChem CID 87256441) has the molecular formula C20H36O12 and a molecular weight of 468.50 g/mol. Its IUPAC name is bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] (Z)-but-2-enedioate.
| Compound Name | bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 87256441 |
| Molecular Formula | C20H36O12 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)OCCOCCOCCOCCO)OCCOCCOCCOCCO |
| InChI | InChI=1S/C20H36O12/c21-3-5-25-7-9-27-11-13-29-15-17-31-19(23)1-2-20(24)32-18-16-30-14-12-28-10-8-26-6-4-22/h1-2,21-22H,3-18H2/b2-1- |
| InChIKey | XRYNLPWIHAJXCO-UPHRSURJSA-N |
| XLogP | -1.29 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|