C19H36O9 — CID 141192139
2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-methylbut-2-enoate (PubChem CID 141192139) has the molecular formula C19H36O9 and a molecular weight of 408.49 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-methylbut-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 141192139 |
| Molecular Formula | C19H36O9 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C19H36O9/c1-18(2)17-19(21)28-16-15-27-14-13-26-12-11-25-10-9-24-8-7-23-6-5-22-4-3-20/h17,20H,3-16H2,1-2H3 |
| InChIKey | ZYIQCEPYKVJIER-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|