C11H20O5 — CID 141002256
[4-hydroxy-3,3-bis(hydroxymethyl)butyl] 3-methylbut-2-enoate (PubChem CID 141002256) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is [4-hydroxy-3,3-bis(hydroxymethyl)butyl] 3-methylbut-2-enoate.
| Compound Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 141002256 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCCC(CO)(CO)CO |
| InChI | InChI=1S/C11H20O5/c1-9(2)5-10(15)16-4-3-11(6-12,7-13)8-14/h5,12-14H,3-4,6-8H2,1-2H3 |
| InChIKey | YKTWXGZJFJIWTH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|