C12H16O11 — CID 175013282
3-[4-hydroxy-3,3-bis(hydroxymethyl)butoxy]-3-oxoprop-1-ene-1,1,2-tricarboxylic acid (PubChem CID 175013282) has the molecular formula C12H16O11 and a molecular weight of 336.25 g/mol. Its IUPAC name is 3-[4-hydroxy-3,3-bis(hydroxymethyl)butoxy]-3-oxoprop-1-ene-1,1,2-tricarboxylic acid.
| Compound Name | 3-[4-hydroxy-3,3-bis(hydroxymethyl)butoxy]-3-oxoprop-1-ene-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 175013282 |
| Molecular Formula | C12H16O11 |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3-[4-hydroxy-3,3-bis(hydroxymethyl)butoxy]-3-oxoprop-1-ene-1,1,2-tricarboxylic acid |
| SMILES | O=C(O)C(C(=O)O)=C(C(=O)O)C(=O)OCCC(CO)(CO)CO |
| InChI | InChI=1S/C12H16O11/c13-3-12(4-14,5-15)1-2-23-11(22)7(10(20)21)6(8(16)17)9(18)19/h13-15H,1-5H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | BQAVYGSRCHNFNO-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|